dspepeg46nh2

Thalidomide-NH-(CH2)2-NH2 TFA is an alkyl-modified derivative of Thalidomide serving as a Cereblon ligand to recruit CRBN proteins and a pivotal intermediate in the synthesis of CRBN-based PROTAC molecules for the targeted small molecule PROTACs aimed at SHP2 protein.

Thalidomide-NH-CBP/p300 ligand 2 (P-007) is a PROTAC-based compound designed to degrade CBP and p300, acting as a functional antagonist (WO2020173440).

Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker employed in the synthesis of PROTACs[1].

DSPE-PEG46-NH2 is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules. This linker enables selective protein degradation by leveraging the ubiquitin-proteasome system within cells.