nh2mpaanoda

NH2-MPAA-NODA, a nitroveratryl-based photocleavable linker featuring a NODA motif and a methyl phenyl acetic acid (MPAA) backbone, serves as a radiolabel when labeled with 18F-fluoride.

Thalidomide-NH-CBP p300 ligand 2 (P-007) is a PROTAC-based compound engineered to degrade the proteins CBP and p300, functioning as a molecular antagonist (WO2020173440).

Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker used in the synthesis of PROTACs [1].

Thalidomide-NH-(CH2)2-NH2 TFA, an alkyl-modified derivative of Thalidomide, functions as a Cereblon ligand to recruit CRBN proteins and serves as a crucial intermediate in the synthesis of CRBN-based PROTAC molecules targeting the SHP2 protein.