nh2oc5cooh hydrobromide

NH2-O-C5-COOH (hydrobromide) is an alkyl chain-derived PROteolysis TArgeting Chimera (PROTAC) linker used in PROTAC synthesis [1].

5-Ethynyl-2'-deoxyuridine (EdU) is a nucleoside analog of thymidine used to monitor de novo DNA synthesis through click chemistry and serves as an alkyl chain-based PROTAC linker for synthesizing PROTACs.

Thalidomide-5-NH2-CH2-COOH (compound 114) is a selective inhibitor of the protomyosin receptor kinase and a ligand for E3 ligase, offering potential for studying various diseases.

Thalidomide-NH-CH2-COOH ((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)glycine) is a synthesized E3 ligase ligand-linker conjugate containing a Thalidomide-based cereblon ligand and a linker.

Thalidomide-5-NH-PEG1-NH2 hydrochloride is a Thalidomide-based cereblon ligand designed for CRBN protein recruitment. It facilitates the formation of PROTAC molecules by linking to target protein ligands, such as THAL-SNS-032, via a connector.

Thalidomide-NH-C10-COOH (compound 6b) is a synthetic E3 ligase ligand-linker conjugate, combining the Thalidomide-based von Hippel-Lindau (VHL) ligand with a linker commonly used in PROTAC technology. [1]

Pomalidomide-C2-amido-(C1-O-C5-O-C1)2-COOH is a chemically synthesized E3 ligase ligand-linker conjugate, incorporating the cereblon ligand from Pomalidomide and a linker used in PROTAC technology. It facilitates targeted protein degradation by modulating E3 ligase activity, thereby enabling the selective elimination of specific proteins of interest.

Thalidomide-NH-(CH2)2-NH2 TFA, an alkyl-modified derivative of Thalidomide, functions as a Cereblon ligand to recruit CRBN proteins and serves as a crucial intermediate in the synthesis of CRBN-based PROTAC molecules targeting the SHP2 protein.

Thalidomide-NH-CBP p300 ligand 2 (P-007) is a PROTAC-based compound engineered to degrade the proteins CBP and p300, functioning as a molecular antagonist (WO2020173440).

Thalidomide-5-COOH is a useful organic compound for research related to life sciences. The catalog number is T64600 and the CAS number is 1216805-11-6.

Thalidomide-NH-PEG2-COOH is a conjugate synthesized as an E3 ligase ligand-linker, incorporating the cereblon ligand from Thalidomide and a linker commonly used in [PROTAC] technology.

Thalidomide-5-NH-PEG3-NH2 hydrochloride is a cereblon ligand based on Thalidomide that targets CRBN proteins. It utilizes a linker to attach to a target protein ligand, facilitating the formation of a PROTAC molecule, such as THAL-SNS-032.

Thalidomide-NH-PEG3-COOH, a conjugate of the E3 ligase ligand-linker synthesized compound, integrates a cereblon ligand based on Thalidomide and a linker employed in PROTAC technology.

Biotinyl-NH-PEG3-C3-amido-C3-COOH (DIPEA) is a polyethylene glycol (PEG)-based PROTAC linker used in the synthesis of proteolysis targeting chimeras (PROTACs).

Thalidomide-5-NH-PEG2-NH2 hydrochloride is a cereblon ligand based on Thalidomide, designed to recruit CRBN proteins. It has the capability to be linked with target protein ligands via a linker, facilitating the formation of PROTAC molecules, such as THAL-SNS-032.

Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker used in the synthesis of PROTACs [1].

Thalidomide-NH-PEG4-COOH is a conjugate comprising an E3 ligase ligand-linker, utilized in the synthesis of dCBP-1. dCBP-1 itself functions as a powerful and selective heterobifunctional degrader targeting p300 CBP.