thalidomidenhc4nh2 tfa

Thalidomide-NH-C4-NH2 TFA (compound 29c) is a conjugate composed of an E3 ligase ligand-linker that integrates a Thalidomide-based cereblon ligand and a linker moiety. This compound is used as a component in PROTAC BRD2 BRD4 degrader-1, a highly potent and selective degrader targeting BET proteins BRD4 and BRD2[1].

PROTAC AR Degrader-4, an Androgen Receptor (AR) degrader, incorporates an IAP ligand binding group, a linker, and an AR binding group. It represents a class of degradation inducers known as specific and non-genetic IAP-dependent protein erasers (SNIPERs) [1], operating through a mechanism involving cIAP1.

Thalidomide-NH-(CH2)2-NH2 TFA, an alkyl-modified derivative of Thalidomide, functions as a Cereblon ligand to recruit CRBN proteins and serves as a crucial intermediate in the synthesis of CRBN-based PROTAC molecules targeting the SHP2 protein.

ZXH-4-130 TFA is a hetero-PROTAC (CRBN-VHL compound) that efficaciously and selectively mediates the degradation of CRBN, achieving approximately 80% degradation at a concentration of 10 nM in MM1.S cells [1].

PROTAC PTPN2 degrader-2 (example 187B) TFA is a potent Protein Tyrosine Phosphatase Non-receptor Type 2 (PTPN2) degrader with potential applications in cancer and metabolic disease research [1].

Ph-Bis(C1-N-(C2-NH-Boc)2) is a versatile alkyl chain-derived linker used in the synthesis of PROTACs [1].

Thalidomide-NH-C6-NH2 TFA is a synthetic conjugate compound that integrates a cereblon ligand derived from Thalidomide with a linker used in PROTAC technology, serving as an E3 ligase ligand-linker conjugate[1].

Thalidomide-NH-CBP p300 ligand 2 (P-007) is a PROTAC-based compound engineered to degrade the proteins CBP and p300, functioning as a molecular antagonist (WO2020173440).

Mal-PEG4-Lys(TFA)-NH-m-PEG24 is a polyethylene glycol (PEG) derivative designed as a PROTAC linker for synthesizing proteolysis targeting chimeras (PROTACs) [1].

4-Methyl-4-(pyridin-2-yldisulfanyl)pentanoic acid is a cleavable linker compound used in the synthesis of antibody-drug conjugates (ADCs) [1].